C37H46N8O4 — CID 170625456
3-[8-[1-[4-[4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]pyrazol-1-yl]cyclohexyl]piperidin-4-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]piperidine-2,6-dione (PubChem CID 170625456) has the molecular formula C37H46N8O4 and a molecular weight of 666.83 g/mol. Its IUPAC name is 3-[8-[1-[4-[4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]pyrazol-1-yl]cyclohexyl]piperidin-4-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]piperidine-2,6-dione.
| Compound Name | 3-[8-[1-[4-[4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]pyrazol-1-yl]cyclohexyl]piperidin-4-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170625456 |
| Molecular Formula | C37H46N8O4 |
| Molecular Weight | 666.83 g/mol |
| Exact Mass | 666.36 |
| IUPAC Name | 3-[8-[1-[4-[4-[(3Z)-1,1,4-triamino-4-(2-hydroxyphenyl)buta-1,3-dien-2-yl]pyrazol-1-yl]cyclohexyl]piperidin-4-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]piperidine-2,6-dione |
| SMILES | NC(N)=C(/C=C(\N)c1ccccc1O)c1cnn(C2CCC(N3CCC(c4cccc5c4OCCN5C4CCC(=O)NC4=O)CC3)CC2)c1 |
| InChI | InChI=1S/C37H46N8O4/c38-30(28-4-1-2-7-33(28)46)20-29(36(39)40)24-21-41-45(22-24)26-10-8-25(9-11-26)43-16-14-23(15-17-43)27-5-3-6-31-35(27)49-19-18-44(31)32-12-13-34(47)42-37(32)48/h1-7,20-23,25-26,32,46H,8-19,38-40H2,(H,42,47,48)/b30-20- |
| InChIKey | NUIFZTHDDJPBTL-COEJQBHMSA-N |
| XLogP | 3.54 |
| TPSA | 177.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|