C24H33FN6O — CID 170624940
4-fluoro-2-[(1Z)-1,4,4-triamino-3-[1-(1-cyclohexylpiperidin-4-yl)pyrazol-4-yl]buta-1,3-dienyl]phenol (PubChem CID 170624940) has the molecular formula C24H33FN6O and a molecular weight of 440.57 g/mol. Its IUPAC name is 4-fluoro-2-[(1Z)-1,4,4-triamino-3-[1-(1-cyclohexylpiperidin-4-yl)pyrazol-4-yl]buta-1,3-dienyl]phenol.
| Compound Name | 4-fluoro-2-[(1Z)-1,4,4-triamino-3-[1-(1-cyclohexylpiperidin-4-yl)pyrazol-4-yl]buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 170624940 |
| Molecular Formula | C24H33FN6O |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 4-fluoro-2-[(1Z)-1,4,4-triamino-3-[1-(1-cyclohexylpiperidin-4-yl)pyrazol-4-yl]buta-1,3-dienyl]phenol |
| SMILES | NC(N)=C(/C=C(\N)c1cc(F)ccc1O)c1cnn(C2CCN(C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C24H33FN6O/c25-17-6-7-23(32)21(12-17)22(26)13-20(24(27)28)16-14-29-31(15-16)19-8-10-30(11-9-19)18-4-2-1-3-5-18/h6-7,12-15,18-19,32H,1-5,8-11,26-28H2/b22-13- |
| InChIKey | OLZXNZGBFFOBCL-XKZIYDEJSA-N |
| XLogP | 3.28 |
| TPSA | 119.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|