C25H18ClN3O — CID 170631876
2-(benzhydrylideneamino)-3-(6-chloro-2-oxo-1H-quinolin-3-yl)propanenitrile (PubChem CID 170631876) has the molecular formula C25H18ClN3O and a molecular weight of 411.89 g/mol. Its IUPAC name is 2-(benzhydrylideneamino)-3-(6-chloro-2-oxo-1H-quinolin-3-yl)propanenitrile.
| Compound Name | 2-(benzhydrylideneamino)-3-(6-chloro-2-oxo-1H-quinolin-3-yl)propanenitrile |
|---|---|
| PubChem CID | 170631876 |
| Molecular Formula | C25H18ClN3O |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-(benzhydrylideneamino)-3-(6-chloro-2-oxo-1H-quinolin-3-yl)propanenitrile |
| SMILES | N#CC(Cc1cc2cc(Cl)ccc2[nH]c1=O)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H18ClN3O/c26-21-11-12-23-19(14-21)13-20(25(30)29-23)15-22(16-27)28-24(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,22H,15H2,(H,29,30) |
| InChIKey | YMINJARURFBGOV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|