C16H27F2NO2 — CID 170632245
6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinoline-3-carbaldehyde;ethane (PubChem CID 170632245) has the molecular formula C16H27F2NO2 and a molecular weight of 303.39 g/mol. Its IUPAC name is 6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinoline-3-carbaldehyde;ethane.
| Compound Name | 6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinoline-3-carbaldehyde;ethane |
|---|---|
| PubChem CID | 170632245 |
| Molecular Formula | C16H27F2NO2 |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 6,6-difluoro-2-oxo-1,5,7,8-tetrahydroquinoline-3-carbaldehyde;ethane |
| SMILES | CC.CC.CC.O=Cc1cc2c([nH]c1=O)CCC(F)(F)C2 |
| InChI | InChI=1S/C10H9F2NO2.3C2H6/c11-10(12)2-1-8-6(4-10)3-7(5-14)9(15)13-8;3*1-2/h3,5H,1-2,4H2,(H,13,15);3*1-2H3 |
| InChIKey | YKHIUXIPJUYIFY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|