C19H34N4OS — CID 170636034
(Z)-4-amino-3-[5-[(E)-2-amino-4-methyliminopent-2-en-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one;butane;ethane (PubChem CID 170636034) has the molecular formula C19H34N4OS and a molecular weight of 366.58 g/mol. Its IUPAC name is (Z)-4-amino-3-[5-[(E)-2-amino-4-methyliminopent-2-en-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one;butane;ethane.
| Compound Name | (Z)-4-amino-3-[5-[(E)-2-amino-4-methyliminopent-2-en-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one;butane;ethane |
|---|---|
| PubChem CID | 170636034 |
| Molecular Formula | C19H34N4OS |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | (Z)-4-amino-3-[5-[(E)-2-amino-4-methyliminopent-2-en-3-yl]-1,3-thiazol-2-yl]but-3-en-2-one;butane;ethane |
| SMILES | C/N=C(C)/C(=C(/C)N)c1cnc(/C(=C\N)C(C)=O)s1.CC.CCCC |
| InChI | InChI=1S/C13H18N4OS.C4H10.C2H6/c1-7(15)12(8(2)16-4)11-6-17-13(19-11)10(5-14)9(3)18;1-3-4-2;1-2/h5-6H,14-15H2,1-4H3;3-4H2,1-2H3;1-2H3/b10-5-,12-7+,16-8+;; |
| InChIKey | SXZFAUUSTBMXEM-MWZPPHKZSA-N |
| XLogP | 4.64 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|