C14H18N2OS — CID 174019344
4-amino-3-[5-(2,4-dimethylpenta-1,3-dien-3-yl)-1,3-thiazol-2-yl]but-3-en-2-one (PubChem CID 174019344) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 4-amino-3-[5-(2,4-dimethylpenta-1,3-dien-3-yl)-1,3-thiazol-2-yl]but-3-en-2-one.
| Compound Name | 4-amino-3-[5-(2,4-dimethylpenta-1,3-dien-3-yl)-1,3-thiazol-2-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 174019344 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-amino-3-[5-(2,4-dimethylpenta-1,3-dien-3-yl)-1,3-thiazol-2-yl]but-3-en-2-one |
| SMILES | C=C(C)C(=C(C)C)c1cnc(C(=CN)C(C)=O)s1 |
| InChI | InChI=1S/C14H18N2OS/c1-8(2)13(9(3)4)12-7-16-14(18-12)11(6-15)10(5)17/h6-7H,1,15H2,2-5H3 |
| InChIKey | IRNSXTHXIRVVMD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|