C27H46N4O3 — CID 170638492
tert-butyl N-[3-[[4-[3-methanimidoyl-4-(methylamino)phenyl]cyclohexyl]oxymethyl]piperidin-4-yl]carbamate;ethane (PubChem CID 170638492) has the molecular formula C27H46N4O3 and a molecular weight of 474.69 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-[3-methanimidoyl-4-(methylamino)phenyl]cyclohexyl]oxymethyl]piperidin-4-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[3-[[4-[3-methanimidoyl-4-(methylamino)phenyl]cyclohexyl]oxymethyl]piperidin-4-yl]carbamate;ethane |
|---|---|
| PubChem CID | 170638492 |
| Molecular Formula | C27H46N4O3 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.36 |
| IUPAC Name | tert-butyl N-[3-[[4-[3-methanimidoyl-4-(methylamino)phenyl]cyclohexyl]oxymethyl]piperidin-4-yl]carbamate;ethane |
| SMILES | CC.[H]/N=C/c1cc(C2CCC(OCC3CNCCC3NC(=O)OC(C)(C)C)CC2)ccc1NC |
| InChI | InChI=1S/C25H40N4O3.C2H6/c1-25(2,3)32-24(30)29-23-11-12-28-15-20(23)16-31-21-8-5-17(6-9-21)18-7-10-22(27-4)19(13-18)14-26;1-2/h7,10,13-14,17,20-21,23,26-28H,5-6,8-9,11-12,15-16H2,1-4H3,(H,29,30);1-2H3/b26-14+; |
| InChIKey | OLOURVMBOXQXDQ-BCUBJXSGSA-N |
| XLogP | 5.30 |
| TPSA | 95.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|