C27H44N4O3S — CID 170638544
tert-butyl 5-[4-[[4-(methylsulfanylamino)piperidin-3-yl]methoxy]cyclohexyl]benzimidazole-1-carboxylate;ethane (PubChem CID 170638544) has the molecular formula C27H44N4O3S and a molecular weight of 504.74 g/mol. Its IUPAC name is tert-butyl 5-[4-[[4-(methylsulfanylamino)piperidin-3-yl]methoxy]cyclohexyl]benzimidazole-1-carboxylate;ethane.
| Compound Name | tert-butyl 5-[4-[[4-(methylsulfanylamino)piperidin-3-yl]methoxy]cyclohexyl]benzimidazole-1-carboxylate;ethane |
|---|---|
| PubChem CID | 170638544 |
| Molecular Formula | C27H44N4O3S |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | tert-butyl 5-[4-[[4-(methylsulfanylamino)piperidin-3-yl]methoxy]cyclohexyl]benzimidazole-1-carboxylate;ethane |
| SMILES | CC.CSNC1CCNCC1COC1CCC(c2ccc3c(c2)ncn3C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C25H38N4O3S.C2H6/c1-25(2,3)32-24(30)29-16-27-22-13-18(7-10-23(22)29)17-5-8-20(9-6-17)31-15-19-14-26-12-11-21(19)28-33-4;1-2/h7,10,13,16-17,19-21,26,28H,5-6,8-9,11-12,14-15H2,1-4H3;1-2H3 |
| InChIKey | XHMGRDGNINGGCM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|