C23H38N4OS — CID 170638624
ethane;3-[[4-(1-methylindazol-5-yl)cyclohexyl]oxymethyl]-N-methylsulfanylpiperidin-4-amine (PubChem CID 170638624) has the molecular formula C23H38N4OS and a molecular weight of 418.65 g/mol. Its IUPAC name is ethane;3-[[4-(1-methylindazol-5-yl)cyclohexyl]oxymethyl]-N-methylsulfanylpiperidin-4-amine.
| Compound Name | ethane;3-[[4-(1-methylindazol-5-yl)cyclohexyl]oxymethyl]-N-methylsulfanylpiperidin-4-amine |
|---|---|
| PubChem CID | 170638624 |
| Molecular Formula | C23H38N4OS |
| Molecular Weight | 418.65 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | ethane;3-[[4-(1-methylindazol-5-yl)cyclohexyl]oxymethyl]-N-methylsulfanylpiperidin-4-amine |
| SMILES | CC.CSNC1CCNCC1COC1CCC(c2ccc3c(cnn3C)c2)CC1 |
| InChI | InChI=1S/C21H32N4OS.C2H6/c1-25-21-8-5-16(11-17(21)13-23-25)15-3-6-19(7-4-15)26-14-18-12-22-10-9-20(18)24-27-2;1-2/h5,8,11,13,15,18-20,22,24H,3-4,6-7,9-10,12,14H2,1-2H3;1-2H3 |
| InChIKey | FUKUYYZMMKISNV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|