C26H40N4O2S — CID 170638497
2,2-dimethyl-1-[3-[[4-(1-methylindazol-5-yl)cyclohexyl]oxymethyl]-4-(methylsulfanylamino)piperidin-1-yl]propan-1-one (PubChem CID 170638497) has the molecular formula C26H40N4O2S and a molecular weight of 472.70 g/mol. Its IUPAC name is 2,2-dimethyl-1-[3-[[4-(1-methylindazol-5-yl)cyclohexyl]oxymethyl]-4-(methylsulfanylamino)piperidin-1-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[3-[[4-(1-methylindazol-5-yl)cyclohexyl]oxymethyl]-4-(methylsulfanylamino)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 170638497 |
| Molecular Formula | C26H40N4O2S |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | 2,2-dimethyl-1-[3-[[4-(1-methylindazol-5-yl)cyclohexyl]oxymethyl]-4-(methylsulfanylamino)piperidin-1-yl]propan-1-one |
| SMILES | CSNC1CCN(C(=O)C(C)(C)C)CC1COC1CCC(c2ccc3c(cnn3C)c2)CC1 |
| InChI | InChI=1S/C26H40N4O2S/c1-26(2,3)25(31)30-13-12-23(28-33-5)21(16-30)17-32-22-9-6-18(7-10-22)19-8-11-24-20(14-19)15-27-29(24)4/h8,11,14-15,18,21-23,28H,6-7,9-10,12-13,16-17H2,1-5H3 |
| InChIKey | QBOVEVXTSIOCLE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|