C25H34N6OS — CID 170638665
3-[[4-(1-methylpyrazolo[3,4-c]pyridin-5-yl)cyclohexyl]oxymethyl]-N-methylsulfanyl-1-pyridin-2-ylpiperidin-4-amine (PubChem CID 170638665) has the molecular formula C25H34N6OS and a molecular weight of 466.66 g/mol. Its IUPAC name is 3-[[4-(1-methylpyrazolo[3,4-c]pyridin-5-yl)cyclohexyl]oxymethyl]-N-methylsulfanyl-1-pyridin-2-ylpiperidin-4-amine.
| Compound Name | 3-[[4-(1-methylpyrazolo[3,4-c]pyridin-5-yl)cyclohexyl]oxymethyl]-N-methylsulfanyl-1-pyridin-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 170638665 |
| Molecular Formula | C25H34N6OS |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 3-[[4-(1-methylpyrazolo[3,4-c]pyridin-5-yl)cyclohexyl]oxymethyl]-N-methylsulfanyl-1-pyridin-2-ylpiperidin-4-amine |
| SMILES | CSNC1CCN(c2ccccn2)CC1COC1CCC(c2cc3cnn(C)c3cn2)CC1 |
| InChI | InChI=1S/C25H34N6OS/c1-30-24-15-27-23(13-19(24)14-28-30)18-6-8-21(9-7-18)32-17-20-16-31(12-10-22(20)29-33-2)25-5-3-4-11-26-25/h3-5,11,13-15,18,20-22,29H,6-10,12,16-17H2,1-2H3 |
| InChIKey | SSAZFINFKPMDSV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|