C19H33LrNO2 — CID 170640479
lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine (PubChem CID 170640479) has the molecular formula C19H33LrNO2 and a molecular weight of 569.48 g/mol. Its IUPAC name is lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine.
| Compound Name | lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine |
|---|---|
| PubChem CID | 170640479 |
| Molecular Formula | C19H33LrNO2 |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 569.36 |
| IUPAC Name | lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine |
| SMILES | CCCC(C)COc1ccc(C(C(C)N)C(C)(C)OC)cc1.[Lr] |
| InChI | InChI=1S/C19H33NO2.Lr/c1-7-8-14(2)13-22-17-11-9-16(10-12-17)18(15(3)20)19(4,5)21-6;/h9-12,14-15,18H,7-8,13,20H2,1-6H3; |
| InChIKey | AZMVBBMSRWGNDU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |