About lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine
lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine (PubChem CID 170640479) has the molecular formula C19H33LrNO2
and a molecular weight of 569.48 g/mol. Its IUPAC name is lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine.
Molecular Properties
| Compound Name | lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine |
| PubChem CID | 170640479 |
| Molecular Formula | C19H33LrNO2 |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 569.36 |
| IUPAC Name | lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine |
| SMILES | CCCC(C)COc1ccc(C(C(C)N)C(C)(C)OC)cc1.[Lr] |
| InChI | InChI=1S/C19H33NO2.Lr/c1-7-8-14(2)13-22-17-11-9-16(10-12-17)18(15(3)20)19(4,5)21-6;/h9-12,14-15,18H,7-8,13,20H2,1-6H3; |
| InChIKey | AZMVBBMSRWGNDU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine?
The IUPAC name of lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine (CID 170640479) is lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine.
What is the SMILES notation for lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine?
The canonical SMILES for lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine is CCCC(C)COc1ccc(C(C(C)N)C(C)(C)OC)cc1.[Lr].
What is the InChIKey of lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine?
The InChIKey is AZMVBBMSRWGNDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33NO2.Lr/c1-7-8-14(2)13-22-17-11-9-16(10-12-17)18(15(3)20)19(4,5)21-6;/h9-12,14-15,18H,7-8,13,20H2,1-6H3;.
What are the key properties of lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine?
lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine has a molecular weight of 569.48 g/mol, XLogP of 4.36, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lawrencium;(3S)-4-methoxy-4-methyl-3-[4-(2-methylpentoxy)phenyl]pentan-2-amine is sourced from PubChem (CID 170640479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).