C16H27NO2 — CID 170640520
2-[(R)-amino-[4-[(2R)-1,1-dideuterio-2-methylpentoxy]phenyl]methyl]-1,1,1,3,3,3-hexadeuteriopropan-2-ol (PubChem CID 170640520) has the molecular formula C16H27NO2 and a molecular weight of 273.45 g/mol. Its IUPAC name is 2-[(R)-amino-[4-[(2R)-1,1-dideuterio-2-methylpentoxy]phenyl]methyl]-1,1,1,3,3,3-hexadeuteriopropan-2-ol.
| Compound Name | 2-[(R)-amino-[4-[(2R)-1,1-dideuterio-2-methylpentoxy]phenyl]methyl]-1,1,1,3,3,3-hexadeuteriopropan-2-ol |
|---|---|
| PubChem CID | 170640520 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 2-[(R)-amino-[4-[(2R)-1,1-dideuterio-2-methylpentoxy]phenyl]methyl]-1,1,1,3,3,3-hexadeuteriopropan-2-ol |
| SMILES | [2H]C([2H])(Oc1ccc([C@@H](N)C(O)(C([2H])([2H])[2H])C([2H])([2H])[2H])cc1)[C@H](C)CCC |
| InChI | InChI=1S/C16H27NO2/c1-5-6-12(2)11-19-14-9-7-13(8-10-14)15(17)16(3,4)18/h7-10,12,15,18H,5-6,11,17H2,1-4H3/t12-,15-/m1/s1/i3D3,4D3,11D2 |
| InChIKey | UQNXIPINZHPXDO-CGZNQLDNSA-N |
| XLogP | 3.27 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |