C24H23ClN6 — CID 170641339
4-[4-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]quinazolin-6-yl]pyridin-2-amine (PubChem CID 170641339) has the molecular formula C24H23ClN6 and a molecular weight of 430.94 g/mol. Its IUPAC name is 4-[4-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]quinazolin-6-yl]pyridin-2-amine.
| Compound Name | 4-[4-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]quinazolin-6-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 170641339 |
| Molecular Formula | C24H23ClN6 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-[4-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]quinazolin-6-yl]pyridin-2-amine |
| SMILES | CN1CCN(c2ccc(-c3ncnc4ccc(-c5ccnc(N)c5)cc34)cc2Cl)CC1 |
| InChI | InChI=1S/C24H23ClN6/c1-30-8-10-31(11-9-30)22-5-3-18(13-20(22)25)24-19-12-16(2-4-21(19)28-15-29-24)17-6-7-27-23(26)14-17/h2-7,12-15H,8-11H2,1H3,(H2,26,27) |
| InChIKey | CGWPQAONVQGEPM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |