C23H20FN5O — CID 170641216
4-[4-(3-fluoro-5-morpholin-4-ylphenyl)quinazolin-6-yl]pyridin-2-amine (PubChem CID 170641216) has the molecular formula C23H20FN5O and a molecular weight of 401.45 g/mol. Its IUPAC name is 4-[4-(3-fluoro-5-morpholin-4-ylphenyl)quinazolin-6-yl]pyridin-2-amine.
| Compound Name | 4-[4-(3-fluoro-5-morpholin-4-ylphenyl)quinazolin-6-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 170641216 |
| Molecular Formula | C23H20FN5O |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 4-[4-(3-fluoro-5-morpholin-4-ylphenyl)quinazolin-6-yl]pyridin-2-amine |
| SMILES | Nc1cc(-c2ccc3ncnc(-c4cc(F)cc(N5CCOCC5)c4)c3c2)ccn1 |
| InChI | InChI=1S/C23H20FN5O/c24-18-9-17(10-19(13-18)29-5-7-30-8-6-29)23-20-11-15(1-2-21(20)27-14-28-23)16-3-4-26-22(25)12-16/h1-4,9-14H,5-8H2,(H2,25,26) |
| InChIKey | UGXLMMUPZHNPAR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |