C24H21F2N5 — CID 170641482
4-[4-[4-(2,4-difluorophenyl)piperidin-1-yl]quinazolin-6-yl]pyridin-2-amine (PubChem CID 170641482) has the molecular formula C24H21F2N5 and a molecular weight of 417.46 g/mol. Its IUPAC name is 4-[4-[4-(2,4-difluorophenyl)piperidin-1-yl]quinazolin-6-yl]pyridin-2-amine.
| Compound Name | 4-[4-[4-(2,4-difluorophenyl)piperidin-1-yl]quinazolin-6-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 170641482 |
| Molecular Formula | C24H21F2N5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 4-[4-[4-(2,4-difluorophenyl)piperidin-1-yl]quinazolin-6-yl]pyridin-2-amine |
| SMILES | Nc1cc(-c2ccc3ncnc(N4CCC(c5ccc(F)cc5F)CC4)c3c2)ccn1 |
| InChI | InChI=1S/C24H21F2N5/c25-18-2-3-19(21(26)13-18)15-6-9-31(10-7-15)24-20-11-16(1-4-22(20)29-14-30-24)17-5-8-28-23(27)12-17/h1-5,8,11-15H,6-7,9-10H2,(H2,27,28) |
| InChIKey | WKBBKOFDFWANNY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |