C21H25F2N7O2 — CID 170642132
4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexan-1-ol (PubChem CID 170642132) has the molecular formula C21H25F2N7O2 and a molecular weight of 445.47 g/mol. Its IUPAC name is 4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 170642132 |
| Molecular Formula | C21H25F2N7O2 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexan-1-ol |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(NC4CCC(O)CC4)nc(OC)c23)cc1NCC(F)F |
| InChI | InChI=1S/C21H25F2N7O2/c1-32-20-19-15(12-2-7-16(28-24)17(10-12)25-11-18(22)23)8-9-30(19)29-21(27-20)26-13-3-5-14(31)6-4-13/h2,7-10,13-14,18,24-25,31H,3-6,11H2,1H3,(H,26,29)/b28-24+ |
| InChIKey | RRNLRSPBIYNBSA-ZZIIXHQDSA-N |
| XLogP | 4.46 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|