C20H22N8O2 — CID 170642523
1-[4-[[5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-4-(trideuteriomethoxy)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone (PubChem CID 170642523) has the molecular formula C20H22N8O2 and a molecular weight of 409.47 g/mol. Its IUPAC name is 1-[4-[[5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-4-(trideuteriomethoxy)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[[5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-4-(trideuteriomethoxy)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 170642523 |
| Molecular Formula | C20H22N8O2 |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 1-[4-[[5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-4-(trideuteriomethoxy)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone |
| SMILES | [2H]C([2H])([2H])Oc1nc(NC2CCN(C(C)=O)CC2)nn2ccc(-c3ccc4ncnn4c3)c12 |
| InChI | InChI=1S/C20H22N8O2/c1-13(29)26-8-5-15(6-9-26)23-20-24-19(30-2)18-16(7-10-27(18)25-20)14-3-4-17-21-12-22-28(17)11-14/h3-4,7,10-12,15H,5-6,8-9H2,1-2H3,(H,23,25)/i2D3 |
| InChIKey | ZNCBWSSIQWUOSP-BMSJAHLVSA-N |
| XLogP | 1.87 |
| TPSA | 101.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |