C21H21F3N8O2 — CID 170642437
1-[(3S)-3-[[4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]pyrrolidin-1-yl]ethanone (PubChem CID 170642437) has the molecular formula C21H21F3N8O2 and a molecular weight of 474.45 g/mol. Its IUPAC name is 1-[(3S)-3-[[4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(3S)-3-[[4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 170642437 |
| Molecular Formula | C21H21F3N8O2 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 1-[(3S)-3-[[4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]pyrrolidin-1-yl]ethanone |
| SMILES | COc1nc(N[C@H]2CCN(C(C)=O)C2)nn2ccc(-c3ccc4nnn(CC(F)(F)F)c4c3)c12 |
| InChI | InChI=1S/C21H21F3N8O2/c1-12(33)30-7-5-14(10-30)25-20-26-19(34-2)18-15(6-8-31(18)28-20)13-3-4-16-17(9-13)32(29-27-16)11-21(22,23)24/h3-4,6,8-9,14H,5,7,10-11H2,1-2H3,(H,25,28)/t14-/m0/s1 |
| InChIKey | WMUKNJAYPHHCQB-AWEZNQCLSA-N |
| XLogP | 2.74 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |