C20H20F3N7O2 — CID 170657407
3-[[4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclobutan-1-ol (PubChem CID 170657407) has the molecular formula C20H20F3N7O2 and a molecular weight of 447.42 g/mol. Its IUPAC name is 3-[[4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclobutan-1-ol.
| Compound Name | 3-[[4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclobutan-1-ol |
|---|---|
| PubChem CID | 170657407 |
| Molecular Formula | C20H20F3N7O2 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 3-[[4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclobutan-1-ol |
| SMILES | COc1nc(NC2CC(C)(O)C2)nn2ccc(-c3ccc4nnn(CC(F)(F)F)c4c3)c12 |
| InChI | InChI=1S/C20H20F3N7O2/c1-19(31)8-12(9-19)24-18-25-17(32-2)16-13(5-6-29(16)27-18)11-3-4-14-15(7-11)30(28-26-14)10-20(21,22)23/h3-7,12,31H,8-10H2,1-2H3,(H,24,27) |
| InChIKey | YZVZGBSOLWMSSK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |