C24H25F5N8O2 — CID 170643053
N-[(4R)-3,3-difluoro-1-(3-methyloxetan-3-yl)piperidin-4-yl]-4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170643053) has the molecular formula C24H25F5N8O2 and a molecular weight of 552.51 g/mol. Its IUPAC name is N-[(4R)-3,3-difluoro-1-(3-methyloxetan-3-yl)piperidin-4-yl]-4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-[(4R)-3,3-difluoro-1-(3-methyloxetan-3-yl)piperidin-4-yl]-4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170643053 |
| Molecular Formula | C24H25F5N8O2 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | N-[(4R)-3,3-difluoro-1-(3-methyloxetan-3-yl)piperidin-4-yl]-4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(N[C@@H]2CCN(C3(C)COC3)CC2(F)F)nn2ccc(-c3ccc4nnn(CC(F)(F)F)c4c3)c12 |
| InChI | InChI=1S/C24H25F5N8O2/c1-22(12-39-13-22)35-7-6-18(23(25,26)10-35)30-21-31-20(38-2)19-15(5-8-36(19)33-21)14-3-4-16-17(9-14)37(34-32-16)11-24(27,28)29/h3-5,8-9,18H,6-7,10-13H2,1-2H3,(H,30,33)/t18-/m1/s1 |
| InChIKey | RFDHSJAAWRUDAP-GOSISDBHSA-N |
| XLogP | 3.62 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |