C23H25F3N8O2 — CID 170642555
5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(3S,4R)-4-fluoro-1-(3-methyloxetan-3-yl)pyrrolidin-3-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170642555) has the molecular formula C23H25F3N8O2 and a molecular weight of 502.50 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(3S,4R)-4-fluoro-1-(3-methyloxetan-3-yl)pyrrolidin-3-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(3S,4R)-4-fluoro-1-(3-methyloxetan-3-yl)pyrrolidin-3-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170642555 |
| Molecular Formula | C23H25F3N8O2 |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(3S,4R)-4-fluoro-1-(3-methyloxetan-3-yl)pyrrolidin-3-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(N[C@H]2CN(C3(C)COC3)C[C@H]2F)nn2ccc(-c3ccc4nnn(CC(F)F)c4c3)c12 |
| InChI | InChI=1S/C23H25F3N8O2/c1-23(11-36-12-23)32-8-15(24)17(9-32)27-22-28-21(35-2)20-14(5-6-33(20)30-22)13-3-4-16-18(7-13)34(31-29-16)10-19(25)26/h3-7,15,17,19H,8-12H2,1-2H3,(H,27,30)/t15-,17+/m1/s1 |
| InChIKey | RFOQFYNONFLJLP-WBVHZDCISA-N |
| XLogP | 2.64 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |