C21H22F4N8O — CID 170641945
5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(4R)-3,3-difluoro-1-(trideuteriomethyl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170641945) has the molecular formula C21H22F4N8O and a molecular weight of 481.47 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(4R)-3,3-difluoro-1-(trideuteriomethyl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(4R)-3,3-difluoro-1-(trideuteriomethyl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170641945 |
| Molecular Formula | C21H22F4N8O |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(4R)-3,3-difluoro-1-(trideuteriomethyl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | [2H]C([2H])([2H])N1CC[C@@H](Nc2nc(OC)c3c(-c4ccc5nnn(CC(F)F)c5c4)ccn3n2)C(F)(F)C1 |
| InChI | InChI=1S/C21H22F4N8O/c1-31-7-6-16(21(24,25)11-31)26-20-27-19(34-2)18-13(5-8-32(18)29-20)12-3-4-14-15(9-12)33(30-28-14)10-17(22)23/h3-5,8-9,16-17H,6-7,10-11H2,1-2H3,(H,26,29)/t16-/m1/s1/i1D3 |
| InChIKey | CFXBADKKSRNSAE-JOTALGBPSA-N |
| XLogP | 3.17 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |