C21H21F5N8O — CID 176803855
5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[3,3-difluoro-1-(trideuteriomethyl)piperidin-4-yl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 176803855) has the molecular formula C21H21F5N8O and a molecular weight of 499.46 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[3,3-difluoro-1-(trideuteriomethyl)piperidin-4-yl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[3,3-difluoro-1-(trideuteriomethyl)piperidin-4-yl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 176803855 |
| Molecular Formula | C21H21F5N8O |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[3,3-difluoro-1-(trideuteriomethyl)piperidin-4-yl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | [2H]C([2H])([2H])N1CCC(Nc2nc(OC)c3c(-c4ccc5nnn(CC(F)F)c5c4)c(F)cn3n2)C(F)(F)C1 |
| InChI | InChI=1S/C21H21F5N8O/c1-32-6-5-15(21(25,26)10-32)27-20-28-19(35-2)18-17(12(22)8-34(18)30-20)11-3-4-13-14(7-11)33(31-29-13)9-16(23)24/h3-4,7-8,15-16H,5-6,9-10H2,1-2H3,(H,27,30)/i1D3 |
| InChIKey | QODAPMZRENRDTJ-FIBGUPNXSA-N |
| XLogP | 3.31 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |