C19H19F3N8O — CID 170657264
N-(3,3-difluoro-1-methylpiperidin-4-yl)-6-fluoro-5-imidazo[1,2-a]pyrimidin-6-yl-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170657264) has the molecular formula C19H19F3N8O and a molecular weight of 432.41 g/mol. Its IUPAC name is N-(3,3-difluoro-1-methylpiperidin-4-yl)-6-fluoro-5-imidazo[1,2-a]pyrimidin-6-yl-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-(3,3-difluoro-1-methylpiperidin-4-yl)-6-fluoro-5-imidazo[1,2-a]pyrimidin-6-yl-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170657264 |
| Molecular Formula | C19H19F3N8O |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-(3,3-difluoro-1-methylpiperidin-4-yl)-6-fluoro-5-imidazo[1,2-a]pyrimidin-6-yl-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(NC2CCN(C)CC2(F)F)nn2cc(F)c(-c3cnc4nccn4c3)c12 |
| InChI | InChI=1S/C19H19F3N8O/c1-28-5-3-13(19(21,22)10-28)25-17-26-16(31-2)15-14(12(20)9-30(15)27-17)11-7-24-18-23-4-6-29(18)8-11/h4,6-9,13H,3,5,10H2,1-2H3,(H,25,27) |
| InChIKey | IBPNLOFLWRRFTD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |