C24H28CmF3N8O- — CID 170642354
curium;5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(3R,4S)-3-fluoro-1-(2-methylpropyl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170642354) has the molecular formula C24H28CmF3N8O- and a molecular weight of 748.54 g/mol. Its IUPAC name is curium;5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(3R,4S)-3-fluoro-1-(2-methylpropyl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | curium;5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(3R,4S)-3-fluoro-1-(2-methylpropyl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170642354 |
| Molecular Formula | C24H28CmF3N8O- |
| Molecular Weight | 748.54 g/mol |
| Exact Mass | 744.30 |
| IUPAC Name | curium;5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(3R,4S)-3-fluoro-1-(2-methylpropyl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(N[C@H]2CCN(C[C-](C)C)C[C@H]2F)nn2ccc(-c3ccc4nnn(CC(F)F)c4c3)c12.[Cm] |
| InChI | InChI=1S/C24H28F3N8O.Cm/c1-14(2)11-33-8-7-18(17(25)12-33)28-24-29-23(36-3)22-16(6-9-34(22)31-24)15-4-5-19-20(10-15)35(32-30-19)13-21(26)27;/h4-6,9-10,17-18,21H,7-8,11-13H2,1-3H3,(H,28,31);/q-1;/t17-,18+;/m1./s1 |
| InChIKey | BBXSGZREYROKTO-URBRKQAFSA-N |
| XLogP | 3.85 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|