C23H26F3N7O — CID 170642696
5-[3-(2,2-difluoroethyl)-2-methylbenzimidazol-5-yl]-N-[(3R,4R)-3-fluoro-1-methylpiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170642696) has the molecular formula C23H26F3N7O and a molecular weight of 473.50 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)-2-methylbenzimidazol-5-yl]-N-[(3R,4R)-3-fluoro-1-methylpiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[3-(2,2-difluoroethyl)-2-methylbenzimidazol-5-yl]-N-[(3R,4R)-3-fluoro-1-methylpiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170642696 |
| Molecular Formula | C23H26F3N7O |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)-2-methylbenzimidazol-5-yl]-N-[(3R,4R)-3-fluoro-1-methylpiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(N[C@@H]2CCN(C)C[C@H]2F)nn2ccc(-c3ccc4nc(C)n(CC(F)F)c4c3)c12 |
| InChI | InChI=1S/C23H26F3N7O/c1-13-27-18-5-4-14(10-19(18)32(13)12-20(25)26)15-6-9-33-21(15)22(34-3)29-23(30-33)28-17-7-8-31(2)11-16(17)24/h4-6,9-10,16-17,20H,7-8,11-12H2,1-3H3,(H,28,30)/t16-,17-/m1/s1 |
| InChIKey | GDRQQDOXYPSRML-IAGOWNOFSA-N |
| XLogP | 3.78 |
| TPSA | 72.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |