C23H25F4N7O — CID 170643016
5-[3-(2,2-difluoroethyl)-7-fluoro-2-methylbenzimidazol-5-yl]-N-[(3S,4S)-3-fluoro-1-methylpiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170643016) has the molecular formula C23H25F4N7O and a molecular weight of 491.49 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)-7-fluoro-2-methylbenzimidazol-5-yl]-N-[(3S,4S)-3-fluoro-1-methylpiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[3-(2,2-difluoroethyl)-7-fluoro-2-methylbenzimidazol-5-yl]-N-[(3S,4S)-3-fluoro-1-methylpiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170643016 |
| Molecular Formula | C23H25F4N7O |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)-7-fluoro-2-methylbenzimidazol-5-yl]-N-[(3S,4S)-3-fluoro-1-methylpiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(N[C@H]2CCN(C)C[C@@H]2F)nn2ccc(-c3cc(F)c4nc(C)n(CC(F)F)c4c3)c12 |
| InChI | InChI=1S/C23H25F4N7O/c1-12-28-20-15(24)8-13(9-18(20)33(12)11-19(26)27)14-4-7-34-21(14)22(35-3)30-23(31-34)29-17-5-6-32(2)10-16(17)25/h4,7-9,16-17,19H,5-6,10-11H2,1-3H3,(H,29,31)/t16-,17-/m0/s1 |
| InChIKey | IFKUGVKVYWHEGV-IRXDYDNUSA-N |
| XLogP | 3.92 |
| TPSA | 72.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |