C24H26F5N7O2 — CID 176803556
5-[3-(2,2-difluoroethyl)-7-fluorobenzimidazol-5-yl]-N-[3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 176803556) has the molecular formula C24H26F5N7O2 and a molecular weight of 539.51 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)-7-fluorobenzimidazol-5-yl]-N-[3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[3-(2,2-difluoroethyl)-7-fluorobenzimidazol-5-yl]-N-[3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 176803556 |
| Molecular Formula | C24H26F5N7O2 |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)-7-fluorobenzimidazol-5-yl]-N-[3,3-difluoro-1-(2-methoxyethyl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COCCN1CCC(Nc2nc(OC)c3c(-c4cc(F)c5ncn(CC(F)F)c5c4)ccn3n2)C(F)(F)C1 |
| InChI | InChI=1S/C24H26F5N7O2/c1-37-8-7-34-5-4-18(24(28,29)12-34)31-23-32-22(38-2)21-15(3-6-36(21)33-23)14-9-16(25)20-17(10-14)35(13-30-20)11-19(26)27/h3,6,9-10,13,18-19H,4-5,7-8,11-12H2,1-2H3,(H,31,33) |
| InChIKey | RJJQXINEXNZIQI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 81.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |