C22H22F5N7O3S — CID 176803461
5-[3-(2,2-difluoroethyl)-7-fluorobenzimidazol-5-yl]-N-(3,3-difluoro-1-methylsulfonylpiperidin-4-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 176803461) has the molecular formula C22H22F5N7O3S and a molecular weight of 559.52 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)-7-fluorobenzimidazol-5-yl]-N-(3,3-difluoro-1-methylsulfonylpiperidin-4-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[3-(2,2-difluoroethyl)-7-fluorobenzimidazol-5-yl]-N-(3,3-difluoro-1-methylsulfonylpiperidin-4-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 176803461 |
| Molecular Formula | C22H22F5N7O3S |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)-7-fluorobenzimidazol-5-yl]-N-(3,3-difluoro-1-methylsulfonylpiperidin-4-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(NC2CCN(S(C)(=O)=O)CC2(F)F)nn2ccc(-c3cc(F)c4ncn(CC(F)F)c4c3)c12 |
| InChI | InChI=1S/C22H22F5N7O3S/c1-37-20-19-13(12-7-14(23)18-15(8-12)32(11-28-18)9-17(24)25)3-6-34(19)31-21(30-20)29-16-4-5-33(38(2,35)36)10-22(16,26)27/h3,6-8,11,16-17H,4-5,9-10H2,1-2H3,(H,29,31) |
| InChIKey | OVZLKFBVAMNCNO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 106.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |