C25H30F3N7O — CID 170642233
5-[3-(2,2-difluoroethyl)-7-fluoro-2-methylbenzimidazol-5-yl]-N-[(3S,4S)-3-ethyl-1-methylpiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170642233) has the molecular formula C25H30F3N7O and a molecular weight of 501.56 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)-7-fluoro-2-methylbenzimidazol-5-yl]-N-[(3S,4S)-3-ethyl-1-methylpiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[3-(2,2-difluoroethyl)-7-fluoro-2-methylbenzimidazol-5-yl]-N-[(3S,4S)-3-ethyl-1-methylpiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170642233 |
| Molecular Formula | C25H30F3N7O |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)-7-fluoro-2-methylbenzimidazol-5-yl]-N-[(3S,4S)-3-ethyl-1-methylpiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | CC[C@H]1CN(C)CC[C@@H]1Nc1nc(OC)c2c(-c3cc(F)c4nc(C)n(CC(F)F)c4c3)ccn2n1 |
| InChI | InChI=1S/C25H30F3N7O/c1-5-15-12-33(3)8-7-19(15)30-25-31-24(36-4)23-17(6-9-35(23)32-25)16-10-18(26)22-20(11-16)34(13-21(27)28)14(2)29-22/h6,9-11,15,19,21H,5,7-8,12-13H2,1-4H3,(H,30,32)/t15-,19-/m0/s1 |
| InChIKey | XZOPYFBXSOFJJD-KXBFYZLASA-N |
| XLogP | 4.61 |
| TPSA | 72.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |