C27H30F3N7O2 — CID 170642439
1-[(3S,4R)-4-[[5-[3-(2,2-difluoroethyl)-7-fluoro-2-methylbenzimidazol-5-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-prop-1-en-2-ylpiperidin-1-yl]ethanone (PubChem CID 170642439) has the molecular formula C27H30F3N7O2 and a molecular weight of 541.58 g/mol. Its IUPAC name is 1-[(3S,4R)-4-[[5-[3-(2,2-difluoroethyl)-7-fluoro-2-methylbenzimidazol-5-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-prop-1-en-2-ylpiperidin-1-yl]ethanone.
| Compound Name | 1-[(3S,4R)-4-[[5-[3-(2,2-difluoroethyl)-7-fluoro-2-methylbenzimidazol-5-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-prop-1-en-2-ylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 170642439 |
| Molecular Formula | C27H30F3N7O2 |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 1-[(3S,4R)-4-[[5-[3-(2,2-difluoroethyl)-7-fluoro-2-methylbenzimidazol-5-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-prop-1-en-2-ylpiperidin-1-yl]ethanone |
| SMILES | C=C(C)[C@H]1CN(C(C)=O)CC[C@H]1Nc1nc(OC)c2c(-c3cc(F)c4nc(C)n(CC(F)F)c4c3)ccn2n1 |
| InChI | InChI=1S/C27H30F3N7O2/c1-14(2)19-12-35(16(4)38)8-7-21(19)32-27-33-26(39-5)25-18(6-9-37(25)34-27)17-10-20(28)24-22(11-17)36(13-23(29)30)15(3)31-24/h6,9-11,19,21,23H,1,7-8,12-13H2,2-5H3,(H,32,34)/t19-,21-/m1/s1 |
| InChIKey | PBKZNUQTJUGZDY-TZIWHRDSSA-N |
| XLogP | 4.69 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|