C25H25F3N8O2 — CID 170643092
5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(3R,4S)-1-(3-ethynyloxetan-3-yl)-3-fluoropiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170643092) has the molecular formula C25H25F3N8O2 and a molecular weight of 526.52 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(3R,4S)-1-(3-ethynyloxetan-3-yl)-3-fluoropiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(3R,4S)-1-(3-ethynyloxetan-3-yl)-3-fluoropiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170643092 |
| Molecular Formula | C25H25F3N8O2 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(3R,4S)-1-(3-ethynyloxetan-3-yl)-3-fluoropiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | C#CC1(N2CC[C@H](Nc3nc(OC)c4c(-c5ccc6nnn(CC(F)F)c6c5)ccn4n3)[C@H](F)C2)COC1 |
| InChI | InChI=1S/C25H25F3N8O2/c1-3-25(13-38-14-25)34-8-7-18(17(26)11-34)29-24-30-23(37-2)22-16(6-9-35(22)32-24)15-4-5-19-20(10-15)36(33-31-19)12-21(27)28/h1,4-6,9-10,17-18,21H,7-8,11-14H2,2H3,(H,29,32)/t17-,18+/m1/s1 |
| InChIKey | XKADDHLZHODVSR-MSOLQXFVSA-N |
| XLogP | 2.64 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|