C19H20FN7O — CID 170642881
N-(3-ethylcyclobutyl)-6-fluoro-4-methoxy-5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170642881) has the molecular formula C19H20FN7O and a molecular weight of 381.42 g/mol. Its IUPAC name is N-(3-ethylcyclobutyl)-6-fluoro-4-methoxy-5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-(3-ethylcyclobutyl)-6-fluoro-4-methoxy-5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170642881 |
| Molecular Formula | C19H20FN7O |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-(3-ethylcyclobutyl)-6-fluoro-4-methoxy-5-([1,2,4]triazolo[1,5-a]pyridin-6-yl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | CCC1CC(Nc2nc(OC)c3c(-c4ccc5ncnn5c4)c(F)cn3n2)C1 |
| InChI | InChI=1S/C19H20FN7O/c1-3-11-6-13(7-11)23-19-24-18(28-2)17-16(14(20)9-27(17)25-19)12-4-5-15-21-10-22-26(15)8-12/h4-5,8-11,13H,3,6-7H2,1-2H3,(H,23,25) |
| InChIKey | VYVJFPVITIWIHG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 81.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |