C23H29F2N7O2 — CID 177156778
4-[[5-[4-diazenyl-3-[[(2S)-2-fluoropropyl]amino]phenyl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 177156778) has the molecular formula C23H29F2N7O2 and a molecular weight of 473.53 g/mol. Its IUPAC name is 4-[[5-[4-diazenyl-3-[[(2S)-2-fluoropropyl]amino]phenyl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[5-[4-diazenyl-3-[[(2S)-2-fluoropropyl]amino]phenyl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 177156778 |
| Molecular Formula | C23H29F2N7O2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 4-[[5-[4-diazenyl-3-[[(2S)-2-fluoropropyl]amino]phenyl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | [H]/N=N/c1ccc(-c2c(F)cn3nc(NC4CCC(C)(O)CC4)nc(OC)c23)cc1NC[C@H](C)F |
| InChI | InChI=1S/C23H29F2N7O2/c1-13(24)11-27-18-10-14(4-5-17(18)30-26)19-16(25)12-32-20(19)21(34-3)29-22(31-32)28-15-6-8-23(2,33)9-7-15/h4-5,10,12-13,15,26-27,33H,6-9,11H2,1-3H3,(H,28,31)/b30-26+/t13-,15?,23?/m0/s1 |
| InChIKey | FFOPLZAIYFZGMB-JOHURENGSA-N |
| XLogP | 5.08 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|