C23H25F5N8O2 — CID 177156797
5-[4-diazenyl-3-(2,2,2-trifluoroethylamino)phenyl]-6-fluoro-N-[(3R,4S)-3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 177156797) has the molecular formula C23H25F5N8O2 and a molecular weight of 540.50 g/mol. Its IUPAC name is 5-[4-diazenyl-3-(2,2,2-trifluoroethylamino)phenyl]-6-fluoro-N-[(3R,4S)-3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[4-diazenyl-3-(2,2,2-trifluoroethylamino)phenyl]-6-fluoro-N-[(3R,4S)-3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 177156797 |
| Molecular Formula | C23H25F5N8O2 |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 5-[4-diazenyl-3-(2,2,2-trifluoroethylamino)phenyl]-6-fluoro-N-[(3R,4S)-3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | [H]/N=N/c1ccc(-c2c(F)cn3nc(N[C@H]4CCN(C5COC5)C[C@H]4F)nc(OC)c23)cc1NCC(F)(F)F |
| InChI | InChI=1S/C23H25F5N8O2/c1-37-21-20-19(12-2-3-17(33-29)18(6-12)30-11-23(26,27)28)15(25)8-36(20)34-22(32-21)31-16-4-5-35(7-14(16)24)13-9-38-10-13/h2-3,6,8,13-14,16,29-30H,4-5,7,9-11H2,1H3,(H,31,34)/b33-29+/t14-,16+/m1/s1 |
| InChIKey | JJONQMZUMYYAOM-GQXXKQFSSA-N |
| XLogP | 4.40 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|