C23H26F4N8O2 — CID 176803888
1-[(3R,4S)-4-[[5-[4-diazenyl-3-(3,3-difluoropropylamino)phenyl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-fluoropiperidin-1-yl]ethanone (PubChem CID 176803888) has the molecular formula C23H26F4N8O2 and a molecular weight of 522.51 g/mol. Its IUPAC name is 1-[(3R,4S)-4-[[5-[4-diazenyl-3-(3,3-difluoropropylamino)phenyl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-fluoropiperidin-1-yl]ethanone.
| Compound Name | 1-[(3R,4S)-4-[[5-[4-diazenyl-3-(3,3-difluoropropylamino)phenyl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-fluoropiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 176803888 |
| Molecular Formula | C23H26F4N8O2 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 1-[(3R,4S)-4-[[5-[4-diazenyl-3-(3,3-difluoropropylamino)phenyl]-6-fluoro-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-fluoropiperidin-1-yl]ethanone |
| SMILES | [H]/N=N/c1ccc(-c2c(F)cn3nc(N[C@H]4CCN(C(C)=O)C[C@H]4F)nc(OC)c23)cc1NCCC(F)F |
| InChI | InChI=1S/C23H26F4N8O2/c1-12(36)34-8-6-16(14(24)10-34)30-23-31-22(37-2)21-20(15(25)11-35(21)33-23)13-3-4-17(32-28)18(9-13)29-7-5-19(26)27/h3-4,9,11,14,16,19,28-29H,5-8,10H2,1-2H3,(H,30,33)/b32-28+/t14-,16+/m1/s1 |
| InChIKey | JDOCZHYYAXTGGQ-IOKLJAOBSA-N |
| XLogP | 4.64 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|