C24H31F2N7O — CID 170643237
5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-N-(4-ethyl-4-methylcyclohexyl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170643237) has the molecular formula C24H31F2N7O and a molecular weight of 471.56 g/mol. Its IUPAC name is 5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-N-(4-ethyl-4-methylcyclohexyl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-N-(4-ethyl-4-methylcyclohexyl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170643237 |
| Molecular Formula | C24H31F2N7O |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-N-(4-ethyl-4-methylcyclohexyl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(NC4CCC(C)(CC)CC4)nc(OC)c23)cc1NCC(F)F |
| InChI | InChI=1S/C24H31F2N7O/c1-4-24(2)10-7-16(8-11-24)29-23-30-22(34-3)21-17(9-12-33(21)32-23)15-5-6-18(31-27)19(13-15)28-14-20(25)26/h5-6,9,12-13,16,20,27-28H,4,7-8,10-11,14H2,1-3H3,(H,29,32)/b31-27+ |
| InChIKey | KHAVLOQQYJKJAY-TVKQRKNISA-N |
| XLogP | 6.52 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|