C21H26F2N8O — CID 170657362
5-[4-diazenyl-3-(methylamino)phenyl]-N-[(4R)-1-ethyl-3,3-difluoropiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170657362) has the molecular formula C21H26F2N8O and a molecular weight of 444.49 g/mol. Its IUPAC name is 5-[4-diazenyl-3-(methylamino)phenyl]-N-[(4R)-1-ethyl-3,3-difluoropiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[4-diazenyl-3-(methylamino)phenyl]-N-[(4R)-1-ethyl-3,3-difluoropiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170657362 |
| Molecular Formula | C21H26F2N8O |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 5-[4-diazenyl-3-(methylamino)phenyl]-N-[(4R)-1-ethyl-3,3-difluoropiperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(N[C@@H]4CCN(CC)CC4(F)F)nc(OC)c23)cc1NC |
| InChI | InChI=1S/C21H26F2N8O/c1-4-30-9-8-17(21(22,23)12-30)26-20-27-19(32-3)18-14(7-10-31(18)29-20)13-5-6-15(28-24)16(11-13)25-2/h5-7,10-11,17,24-25H,4,8-9,12H2,1-3H3,(H,26,29)/b28-24+/t17-/m1/s1 |
| InChIKey | RVCVCQLRCSEHAA-MHHKKEGSSA-N |
| XLogP | 4.25 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|