C21H22F4N8O2 — CID 170657457
2,2,2-trideuterio-1-[(4R)-4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3,3-difluoropyrrolidin-1-yl]ethanone (PubChem CID 170657457) has the molecular formula C21H22F4N8O2 and a molecular weight of 497.47 g/mol. Its IUPAC name is 2,2,2-trideuterio-1-[(4R)-4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3,3-difluoropyrrolidin-1-yl]ethanone.
| Compound Name | 2,2,2-trideuterio-1-[(4R)-4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3,3-difluoropyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 170657457 |
| Molecular Formula | C21H22F4N8O2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 2,2,2-trideuterio-1-[(4R)-4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3,3-difluoropyrrolidin-1-yl]ethanone |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(N[C@@H]4CN(C(=O)C([2H])([2H])[2H])CC4(F)F)nc(OC)c23)cc1NCC(F)F |
| InChI | InChI=1S/C21H22F4N8O2/c1-11(34)32-9-16(21(24,25)10-32)28-20-29-19(35-2)18-13(5-6-33(18)31-20)12-3-4-14(30-26)15(7-12)27-8-17(22)23/h3-7,16-17,26-27H,8-10H2,1-2H3,(H,28,31)/b30-26+/t16-/m1/s1/i1D3 |
| InChIKey | TYAASAQYHBBRQT-BETJQQJYSA-N |
| XLogP | 4.02 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|