C27H35F2N9O2 — CID 177156199
[(4S)-4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3,3-dimethylpiperidin-1-yl]-pyrrolidin-1-ylmethanone (PubChem CID 177156199) has the molecular formula C27H35F2N9O2 and a molecular weight of 555.63 g/mol. Its IUPAC name is [(4S)-4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3,3-dimethylpiperidin-1-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(4S)-4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3,3-dimethylpiperidin-1-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 177156199 |
| Molecular Formula | C27H35F2N9O2 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | [(4S)-4-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3,3-dimethylpiperidin-1-yl]-pyrrolidin-1-ylmethanone |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(N[C@H]4CCN(C(=O)N5CCCC5)CC4(C)C)nc(OC)c23)cc1NCC(F)F |
| InChI | InChI=1S/C27H35F2N9O2/c1-27(2)16-37(26(39)36-10-4-5-11-36)12-9-21(27)32-25-33-24(40-3)23-18(8-13-38(23)35-25)17-6-7-19(34-30)20(14-17)31-15-22(28)29/h6-8,13-14,21-22,30-31H,4-5,9-12,15-16H2,1-3H3,(H,32,35)/b34-30+/t21-/m0/s1 |
| InChIKey | AYZHMSPVBMMFAG-UZWTXYIASA-N |
| XLogP | 5.47 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|