C23H29FN8O2 — CID 170643027
5-[4-diazenyl-3-(ethylamino)phenyl]-N-[(3R,4S)-3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170643027) has the molecular formula C23H29FN8O2 and a molecular weight of 468.54 g/mol. Its IUPAC name is 5-[4-diazenyl-3-(ethylamino)phenyl]-N-[(3R,4S)-3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[4-diazenyl-3-(ethylamino)phenyl]-N-[(3R,4S)-3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170643027 |
| Molecular Formula | C23H29FN8O2 |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 5-[4-diazenyl-3-(ethylamino)phenyl]-N-[(3R,4S)-3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(N[C@H]4CCN(C5COC5)C[C@H]4F)nc(OC)c23)cc1NCC |
| InChI | InChI=1S/C23H29FN8O2/c1-3-26-20-10-14(4-5-19(20)29-25)16-6-9-32-21(16)22(33-2)28-23(30-32)27-18-7-8-31(11-17(18)24)15-12-34-13-15/h4-6,9-10,15,17-18,25-26H,3,7-8,11-13H2,1-2H3,(H,27,30)/b29-25+/t17-,18+/m1/s1 |
| InChIKey | POSIRTMWJBHCTM-LVFSTDESSA-N |
| XLogP | 3.72 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|