C22H27N7O2 — CID 170641906
4-[5-[4-diazenyl-3-(ethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]imino-1-methylcyclohexan-1-ol (PubChem CID 170641906) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is 4-[5-[4-diazenyl-3-(ethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]imino-1-methylcyclohexan-1-ol.
| Compound Name | 4-[5-[4-diazenyl-3-(ethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]imino-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 170641906 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 4-[5-[4-diazenyl-3-(ethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]imino-1-methylcyclohexan-1-ol |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(N=C4CCC(C)(O)CC4)nc(OC)c23)cc1NCC |
| InChI | InChI=1S/C22H27N7O2/c1-4-24-18-13-14(5-6-17(18)27-23)16-9-12-29-19(16)20(31-3)26-21(28-29)25-15-7-10-22(2,30)11-8-15/h5-6,9,12-13,23-24,30H,4,7-8,10-11H2,1-3H3/b25-15-,27-23+ |
| InChIKey | NZRLPSTWHIHKER-XNBVICNUSA-N |
| XLogP | 4.90 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|