C24H29N7O2 — CID 170643083
1-[2-[[5-(6,7-dihydropyrazolo[1,5-a]pyridin-5-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-7-azaspiro[3.5]nonan-7-yl]ethanone (PubChem CID 170643083) has the molecular formula C24H29N7O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-[2-[[5-(6,7-dihydropyrazolo[1,5-a]pyridin-5-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-7-azaspiro[3.5]nonan-7-yl]ethanone.
| Compound Name | 1-[2-[[5-(6,7-dihydropyrazolo[1,5-a]pyridin-5-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-7-azaspiro[3.5]nonan-7-yl]ethanone |
|---|---|
| PubChem CID | 170643083 |
| Molecular Formula | C24H29N7O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 1-[2-[[5-(6,7-dihydropyrazolo[1,5-a]pyridin-5-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-7-azaspiro[3.5]nonan-7-yl]ethanone |
| SMILES | COc1nc(NC2CC3(CCN(C(C)=O)CC3)C2)nn2ccc(C3=Cc4ccnn4CC3)c12 |
| InChI | InChI=1S/C24H29N7O2/c1-16(32)29-11-6-24(7-12-29)14-18(15-24)26-23-27-22(33-2)21-20(5-10-31(21)28-23)17-4-9-30-19(13-17)3-8-25-30/h3,5,8,10,13,18H,4,6-7,9,11-12,14-15H2,1-2H3,(H,26,28) |
| InChIKey | LDNSYZAFQRRCTJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |