C22H18F4N2O3S — CID 170647826
3-(2,6-difluoro-4-methoxyphenyl)-2,4-difluoro-N-[4-(3-hydroxypropylsulfanyl)-3-pyridinyl]benzamide (PubChem CID 170647826) has the molecular formula C22H18F4N2O3S and a molecular weight of 466.46 g/mol. Its IUPAC name is 3-(2,6-difluoro-4-methoxyphenyl)-2,4-difluoro-N-[4-(3-hydroxypropylsulfanyl)-3-pyridinyl]benzamide.
| Compound Name | 3-(2,6-difluoro-4-methoxyphenyl)-2,4-difluoro-N-[4-(3-hydroxypropylsulfanyl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 170647826 |
| Molecular Formula | C22H18F4N2O3S |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 3-(2,6-difluoro-4-methoxyphenyl)-2,4-difluoro-N-[4-(3-hydroxypropylsulfanyl)-3-pyridinyl]benzamide |
| SMILES | COc1cc(F)c(-c2c(F)ccc(C(=O)Nc3cnccc3SCCCO)c2F)c(F)c1 |
| InChI | InChI=1S/C22H18F4N2O3S/c1-31-12-9-15(24)19(16(25)10-12)20-14(23)4-3-13(21(20)26)22(30)28-17-11-27-6-5-18(17)32-8-2-7-29/h3-6,9-11,29H,2,7-8H2,1H3,(H,28,30) |
| InChIKey | UZAOUBGVPWECGB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|