C29H27F2N7O — CID 170648979
7-[4-[5-(2,6-difluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-1-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 170648979) has the molecular formula C29H27F2N7O and a molecular weight of 527.58 g/mol. Its IUPAC name is 7-[4-[5-(2,6-difluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-1-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-[4-[5-(2,6-difluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-1-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 170648979 |
| Molecular Formula | C29H27F2N7O |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 7-[4-[5-(2,6-difluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-1-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC1NCCc2ccc(-n3cc(-c4nn(C5CCCCO5)c5ccc(-c6ccc(F)nc6F)cc45)nn3)cc21 |
| InChI | InChI=1S/C29H27F2N7O/c1-17-22-15-20(7-5-18(22)11-12-32-17)37-16-24(34-36-37)28-23-14-19(21-8-10-26(30)33-29(21)31)6-9-25(23)38(35-28)27-4-2-3-13-39-27/h5-10,14-17,27,32H,2-4,11-13H2,1H3 |
| InChIKey | RVGBHKUBRQTQCX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|