C16H14BrNO3 — CID 170651023
2-(5-bromo-2-hydroxyphenyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 170651023) has the molecular formula C16H14BrNO3 and a molecular weight of 348.20 g/mol. Its IUPAC name is 2-(5-bromo-2-hydroxyphenyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | 2-(5-bromo-2-hydroxyphenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 170651023 |
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 2-(5-bromo-2-hydroxyphenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | NC(=O)C1Cc2ccccc2OC1c1cc(Br)ccc1O |
| InChI | InChI=1S/C16H14BrNO3/c17-10-5-6-13(19)11(8-10)15-12(16(18)20)7-9-3-1-2-4-14(9)21-15/h1-6,8,12,15,19H,7H2,(H2,18,20) |
| InChIKey | ZDDUVNLXIQZXQJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |