C15H12BrNO2 — CID 129363709
(3S)-3-(5-bromo-2-hydroxyphenyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 129363709) has the molecular formula C15H12BrNO2 and a molecular weight of 318.17 g/mol. Its IUPAC name is (3S)-3-(5-bromo-2-hydroxyphenyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | (3S)-3-(5-bromo-2-hydroxyphenyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 129363709 |
| Molecular Formula | C15H12BrNO2 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | (3S)-3-(5-bromo-2-hydroxyphenyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1Nc2ccccc2C[C@H]1c1cc(Br)ccc1O |
| InChI | InChI=1S/C15H12BrNO2/c16-10-5-6-14(18)11(8-10)12-7-9-3-1-2-4-13(9)17-15(12)19/h1-6,8,12,18H,7H2,(H,17,19)/t12-/m0/s1 |
| InChIKey | NUPSDFHIVJJEBQ-LBPRGKRZSA-N |
| XLogP | 3.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |