C13H18N2O3 — CID 170653035
1-(1-tert-butylpyrrolidine-2-carbonyl)pyrrole-2,5-dione (PubChem CID 170653035) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-(1-tert-butylpyrrolidine-2-carbonyl)pyrrole-2,5-dione.
| Compound Name | 1-(1-tert-butylpyrrolidine-2-carbonyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 170653035 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 1-(1-tert-butylpyrrolidine-2-carbonyl)pyrrole-2,5-dione |
| SMILES | CC(C)(C)N1CCCC1C(=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H18N2O3/c1-13(2,3)14-8-4-5-9(14)12(18)15-10(16)6-7-11(15)17/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | OQGWYPCEZZZFMD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|