C17H16N4O4 — CID 170655504
4-amino-2-[2-(1H-indol-3-yl)ethylamino]-5-nitrobenzoic acid (PubChem CID 170655504) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 4-amino-2-[2-(1H-indol-3-yl)ethylamino]-5-nitrobenzoic acid.
| Compound Name | 4-amino-2-[2-(1H-indol-3-yl)ethylamino]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 170655504 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-amino-2-[2-(1H-indol-3-yl)ethylamino]-5-nitrobenzoic acid |
| SMILES | Nc1cc(NCCc2c[nH]c3ccccc23)c(C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N4O4/c18-13-8-15(12(17(22)23)7-16(13)21(24)25)19-6-5-10-9-20-14-4-2-1-3-11(10)14/h1-4,7-9,19-20H,5-6,18H2,(H,22,23) |
| InChIKey | BHZSNUSFIUCOCH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 134.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|